C16H17NO2 — CID 59893475
3-(7-ethanimidoylnaphthalen-2-yl)-2-methylpropanoic acid (PubChem CID 59893475) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-(7-ethanimidoylnaphthalen-2-yl)-2-methylpropanoic acid.
| Compound Name | 3-(7-ethanimidoylnaphthalen-2-yl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 59893475 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-(7-ethanimidoylnaphthalen-2-yl)-2-methylpropanoic acid |
| SMILES | [H]/N=C(\C)c1ccc2ccc(CC(C)C(=O)O)cc2c1 |
| InChI | InChI=1S/C16H17NO2/c1-10(16(18)19)7-12-3-4-13-5-6-14(11(2)17)9-15(13)8-12/h3-6,8-10,17H,7H2,1-2H3,(H,18,19)/b17-11+ |
| InChIKey | UUXAECOGLPZKJW-GZTJUZNOSA-N |
| XLogP | 3.49 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|