C19H23NO3 — CID 90924186
2-(1-hydroxypropan-2-yl)-3-imino-8,8-dimethyl-6,7-dihydro-5H-phenanthrene-1,4-dione (PubChem CID 90924186) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-yl)-3-imino-8,8-dimethyl-6,7-dihydro-5H-phenanthrene-1,4-dione.
| Compound Name | 2-(1-hydroxypropan-2-yl)-3-imino-8,8-dimethyl-6,7-dihydro-5H-phenanthrene-1,4-dione |
|---|---|
| PubChem CID | 90924186 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-(1-hydroxypropan-2-yl)-3-imino-8,8-dimethyl-6,7-dihydro-5H-phenanthrene-1,4-dione |
| SMILES | [H]/N=C1\C(=O)c2c(ccc3c2CCCC3(C)C)C(=O)C1C(C)CO |
| InChI | InChI=1S/C19H23NO3/c1-10(9-21)14-16(20)18(23)15-11-5-4-8-19(2,3)13(11)7-6-12(15)17(14)22/h6-7,10,14,20-21H,4-5,8-9H2,1-3H3/b20-16- |
| InChIKey | USJATULIPNKZBG-SILNSSARSA-N |
| XLogP | 2.94 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|