C35H40N2O2 — CID 91569332
2-(1-hydroxypropan-2-yl)-8,8-dimethyl-3,4-bis(2-phenylethylimino)-6,7-dihydro-5H-phenanthren-1-one (PubChem CID 91569332) has the molecular formula C35H40N2O2 and a molecular weight of 520.72 g/mol. Its IUPAC name is 2-(1-hydroxypropan-2-yl)-8,8-dimethyl-3,4-bis(2-phenylethylimino)-6,7-dihydro-5H-phenanthren-1-one.
| Compound Name | 2-(1-hydroxypropan-2-yl)-8,8-dimethyl-3,4-bis(2-phenylethylimino)-6,7-dihydro-5H-phenanthren-1-one |
|---|---|
| PubChem CID | 91569332 |
| Molecular Formula | C35H40N2O2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | 2-(1-hydroxypropan-2-yl)-8,8-dimethyl-3,4-bis(2-phenylethylimino)-6,7-dihydro-5H-phenanthren-1-one |
| SMILES | CC(CO)C1C(=O)c2ccc3c(c2C(=N/CCc2ccccc2)/C1=N/CCc1ccccc1)CCCC3(C)C |
| InChI | InChI=1S/C35H40N2O2/c1-24(23-38)30-32(36-21-18-25-11-6-4-7-12-25)33(37-22-19-26-13-8-5-9-14-26)31-27-15-10-20-35(2,3)29(27)17-16-28(31)34(30)39/h4-9,11-14,16-17,24,30,38H,10,15,18-23H2,1-3H3/b36-32+,37-33- |
| InChIKey | JKDDZWQERJICDQ-NTIVTGMGSA-N |
| XLogP | 6.46 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|