C15H25NO — CID 143804979
4-cyclohepta-1,4,6-trien-1-yl-1-methylpiperidin-4-ol;ethane (PubChem CID 143804979) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 4-cyclohepta-1,4,6-trien-1-yl-1-methylpiperidin-4-ol;ethane.
| Compound Name | 4-cyclohepta-1,4,6-trien-1-yl-1-methylpiperidin-4-ol;ethane |
|---|---|
| PubChem CID | 143804979 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 4-cyclohepta-1,4,6-trien-1-yl-1-methylpiperidin-4-ol;ethane |
| SMILES | CC.CN1CCC(O)(C2=CCC=CC=C2)CC1 |
| InChI | InChI=1S/C13H19NO.C2H6/c1-14-10-8-13(15,9-11-14)12-6-4-2-3-5-7-12;1-2/h2-4,6-7,15H,5,8-11H2,1H3;1-2H3 |
| InChIKey | LFKVTEISPAWLTB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |