C18H26O2 — CID 143805075
7-ethyl-6-methyl-2,2-dipropyl-3H-chromen-4-one (PubChem CID 143805075) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 7-ethyl-6-methyl-2,2-dipropyl-3H-chromen-4-one.
| Compound Name | 7-ethyl-6-methyl-2,2-dipropyl-3H-chromen-4-one |
|---|---|
| PubChem CID | 143805075 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 7-ethyl-6-methyl-2,2-dipropyl-3H-chromen-4-one |
| SMILES | CCCC1(CCC)CC(=O)c2cc(C)c(CC)cc2O1 |
| InChI | InChI=1S/C18H26O2/c1-5-8-18(9-6-2)12-16(19)15-10-13(4)14(7-3)11-17(15)20-18/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | OPXKPTDLCOYQDN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |