C39H55N3O2 — CID 143806508
1-[4-(2-cyclooctyl-2-prop-2-enylhydrazinyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]pyrrolidin-2-one;toluene (PubChem CID 143806508) has the molecular formula C39H55N3O2 and a molecular weight of 597.89 g/mol. Its IUPAC name is 1-[4-(2-cyclooctyl-2-prop-2-enylhydrazinyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]pyrrolidin-2-one;toluene.
| Compound Name | 1-[4-(2-cyclooctyl-2-prop-2-enylhydrazinyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]pyrrolidin-2-one;toluene |
|---|---|
| PubChem CID | 143806508 |
| Molecular Formula | C39H55N3O2 |
| Molecular Weight | 597.89 g/mol |
| Exact Mass | 597.43 |
| IUPAC Name | 1-[4-(2-cyclooctyl-2-prop-2-enylhydrazinyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]pyrrolidin-2-one;toluene |
| SMILES | C=CCN(Nc1ccc(N2CCC(OC(C)(C)C)C2=O)cc1)C1CCCCCCC1.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C25H39N3O2.2C7H8/c1-5-18-28(22-11-9-7-6-8-10-12-22)26-20-13-15-21(16-14-20)27-19-17-23(24(27)29)30-25(2,3)4;2*1-7-5-3-2-4-6-7/h5,13-16,22-23,26H,1,6-12,17-19H2,2-4H3;2*2-6H,1H3 |
| InChIKey | WXDMCGHGBGOCKF-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.89 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|