C21H33N3O2 — CID 143806545
1-[4-(2-cycloheptylhydrazinyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]pyrrolidin-2-one (PubChem CID 143806545) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-[4-(2-cycloheptylhydrazinyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]pyrrolidin-2-one.
| Compound Name | 1-[4-(2-cycloheptylhydrazinyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143806545 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 1-[4-(2-cycloheptylhydrazinyl)phenyl]-3-[(2-methylpropan-2-yl)oxy]pyrrolidin-2-one |
| SMILES | CC(C)(C)OC1CCN(c2ccc(NNC3CCCCCC3)cc2)C1=O |
| InChI | InChI=1S/C21H33N3O2/c1-21(2,3)26-19-14-15-24(20(19)25)18-12-10-17(11-13-18)23-22-16-8-6-4-5-7-9-16/h10-13,16,19,22-23H,4-9,14-15H2,1-3H3 |
| InChIKey | CXNPWNARBBXKEJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|