C26H34N2O2 — CID 123434168
1-[4-(2-methoxypropan-2-yl)phenyl]-3-[(2-piperidin-1-ylphenyl)methyl]pyrrolidin-2-one (PubChem CID 123434168) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 1-[4-(2-methoxypropan-2-yl)phenyl]-3-[(2-piperidin-1-ylphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 1-[4-(2-methoxypropan-2-yl)phenyl]-3-[(2-piperidin-1-ylphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123434168 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1-[4-(2-methoxypropan-2-yl)phenyl]-3-[(2-piperidin-1-ylphenyl)methyl]pyrrolidin-2-one |
| SMILES | COC(C)(C)c1ccc(N2CCC(Cc3ccccc3N3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C26H34N2O2/c1-26(2,30-3)22-11-13-23(14-12-22)28-18-15-21(25(28)29)19-20-9-5-6-10-24(20)27-16-7-4-8-17-27/h5-6,9-14,21H,4,7-8,15-19H2,1-3H3 |
| InChIKey | PMHITSJWPSJJGD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |