C22H26N3OY- — CID 59782591
(3S)-3-[[2-(4-(111C)methylpiperazin-1-yl)phenyl]methyl]-1-phenylpyrrolidin-2-one;yttrium (PubChem CID 59782591) has the molecular formula C22H26N3OY- and a molecular weight of 436.38 g/mol. Its IUPAC name is (3S)-3-[[2-(4-(111C)methylpiperazin-1-yl)phenyl]methyl]-1-phenylpyrrolidin-2-one;yttrium.
| Compound Name | (3S)-3-[[2-(4-(111C)methylpiperazin-1-yl)phenyl]methyl]-1-phenylpyrrolidin-2-one;yttrium |
|---|---|
| PubChem CID | 59782591 |
| Molecular Formula | C22H26N3OY- |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | (3S)-3-[[2-(4-(111C)methylpiperazin-1-yl)phenyl]methyl]-1-phenylpyrrolidin-2-one;yttrium |
| SMILES | [11CH3]N1CCN(c2ccccc2C[C@H]2CCN(c3cc[c-]cc3)C2=O)CC1.[Y] |
| InChI | InChI=1S/C22H26N3O.Y/c1-23-13-15-24(16-14-23)21-10-6-5-7-18(21)17-19-11-12-25(22(19)26)20-8-3-2-4-9-20;/h3-10,19H,11-17H2,1H3;/q-1;/t19-;/m1./s1/i1-1; |
| InChIKey | SWHMDHGLXALFJY-YCFQLMERSA-N |
| XLogP | 2.83 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|