C21H24N3OY- — CID 59782565
(3R)-1-phenyl-3-[(2-piperazin-1-ylphenyl)methyl]pyrrolidin-2-one;yttrium (PubChem CID 59782565) has the molecular formula C21H24N3OY- and a molecular weight of 423.35 g/mol. Its IUPAC name is (3R)-1-phenyl-3-[(2-piperazin-1-ylphenyl)methyl]pyrrolidin-2-one;yttrium.
| Compound Name | (3R)-1-phenyl-3-[(2-piperazin-1-ylphenyl)methyl]pyrrolidin-2-one;yttrium |
|---|---|
| PubChem CID | 59782565 |
| Molecular Formula | C21H24N3OY- |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (3R)-1-phenyl-3-[(2-piperazin-1-ylphenyl)methyl]pyrrolidin-2-one;yttrium |
| SMILES | O=C1[C@H](Cc2ccccc2N2CCNCC2)CCN1c1cc[c-]cc1.[Y] |
| InChI | InChI=1S/C21H24N3O.Y/c25-21-18(10-13-24(21)19-7-2-1-3-8-19)16-17-6-4-5-9-20(17)23-14-11-22-12-15-23;/h2-9,18,22H,10-16H2;/q-1;/t18-;/m0./s1 |
| InChIKey | BPCNOBWQDLTZHF-FERBBOLQSA-N |
| XLogP | 2.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|