C26H35N3O2S — CID 143260616
(3S)-1-[4-(2-methoxypropan-2-yl)phenyl]-3-[[2-(4-methylsulfanylpiperazin-1-yl)phenyl]methyl]pyrrolidin-2-one (PubChem CID 143260616) has the molecular formula C26H35N3O2S and a molecular weight of 453.65 g/mol. Its IUPAC name is (3S)-1-[4-(2-methoxypropan-2-yl)phenyl]-3-[[2-(4-methylsulfanylpiperazin-1-yl)phenyl]methyl]pyrrolidin-2-one.
| Compound Name | (3S)-1-[4-(2-methoxypropan-2-yl)phenyl]-3-[[2-(4-methylsulfanylpiperazin-1-yl)phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 143260616 |
| Molecular Formula | C26H35N3O2S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | (3S)-1-[4-(2-methoxypropan-2-yl)phenyl]-3-[[2-(4-methylsulfanylpiperazin-1-yl)phenyl]methyl]pyrrolidin-2-one |
| SMILES | COC(C)(C)c1ccc(N2CC[C@H](Cc3ccccc3N3CCN(SC)CC3)C2=O)cc1 |
| InChI | InChI=1S/C26H35N3O2S/c1-26(2,31-3)22-9-11-23(12-10-22)29-14-13-21(25(29)30)19-20-7-5-6-8-24(20)27-15-17-28(32-4)18-16-27/h5-12,21H,13-19H2,1-4H3/t21-/m1/s1 |
| InChIKey | IZRGSQGSWSPFRK-OAQYLSRUSA-N |
| XLogP | 4.56 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|