C17H28O2 — CID 143806809
2-(5-ethoxy-4,4-dimethylpentyl)-1-methoxy-4-methylbenzene (PubChem CID 143806809) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-(5-ethoxy-4,4-dimethylpentyl)-1-methoxy-4-methylbenzene.
| Compound Name | 2-(5-ethoxy-4,4-dimethylpentyl)-1-methoxy-4-methylbenzene |
|---|---|
| PubChem CID | 143806809 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-(5-ethoxy-4,4-dimethylpentyl)-1-methoxy-4-methylbenzene |
| SMILES | CCOCC(C)(C)CCCc1cc(C)ccc1OC |
| InChI | InChI=1S/C17H28O2/c1-6-19-13-17(3,4)11-7-8-15-12-14(2)9-10-16(15)18-5/h9-10,12H,6-8,11,13H2,1-5H3 |
| InChIKey | PEKPZXPRPIAIMY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |