C21H33NO3 — CID 143807784
benzaldehyde;1,3-dimethylcyclopentane;1-methylpiperidine-4-carboxylic acid (PubChem CID 143807784) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is benzaldehyde;1,3-dimethylcyclopentane;1-methylpiperidine-4-carboxylic acid.
| Compound Name | benzaldehyde;1,3-dimethylcyclopentane;1-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 143807784 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | benzaldehyde;1,3-dimethylcyclopentane;1-methylpiperidine-4-carboxylic acid |
| SMILES | CC1CCC(C)C1.CN1CCC(C(=O)O)CC1.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H13NO2.C7H6O.C7H14/c1-8-4-2-6(3-5-8)7(9)10;8-6-7-4-2-1-3-5-7;1-6-3-4-7(2)5-6/h6H,2-5H2,1H3,(H,9,10);1-6H;6-7H,3-5H2,1-2H3 |
| InChIKey | RZCHWVPKUCTGHR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|