C14H27Cl3N2O3 — CID 159086943
1-methylpiperidine-4-carbonyl chloride;1-methylpiperidine-4-carboxylic acid;dihydrochloride (PubChem CID 159086943) has the molecular formula C14H27Cl3N2O3 and a molecular weight of 377.74 g/mol. Its IUPAC name is 1-methylpiperidine-4-carbonyl chloride;1-methylpiperidine-4-carboxylic acid;dihydrochloride.
| Compound Name | 1-methylpiperidine-4-carbonyl chloride;1-methylpiperidine-4-carboxylic acid;dihydrochloride |
|---|---|
| PubChem CID | 159086943 |
| Molecular Formula | C14H27Cl3N2O3 |
| Molecular Weight | 377.74 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 1-methylpiperidine-4-carbonyl chloride;1-methylpiperidine-4-carboxylic acid;dihydrochloride |
| SMILES | CN1CCC(C(=O)Cl)CC1.CN1CCC(C(=O)O)CC1.Cl.Cl |
| InChI | InChI=1S/C7H12ClNO.C7H13NO2.2ClH/c1-9-4-2-6(3-5-9)7(8)10;1-8-4-2-6(3-5-8)7(9)10;;/h6H,2-5H2,1H3;6H,2-5H2,1H3,(H,9,10);2*1H |
| InChIKey | KBOAZNWHRLBCKO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|