C7H15ClN2O2 — CID 141414728
1-(methylamino)piperidine-4-carboxylic acid;hydrochloride (PubChem CID 141414728) has the molecular formula C7H15ClN2O2 and a molecular weight of 194.66 g/mol. Its IUPAC name is 1-(methylamino)piperidine-4-carboxylic acid;hydrochloride.
| Compound Name | 1-(methylamino)piperidine-4-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 141414728 |
| Molecular Formula | C7H15ClN2O2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-(methylamino)piperidine-4-carboxylic acid;hydrochloride |
| SMILES | CNN1CCC(C(=O)O)CC1.Cl |
| InChI | InChI=1S/C7H14N2O2.ClH/c1-8-9-4-2-6(3-5-9)7(10)11;/h6,8H,2-5H2,1H3,(H,10,11);1H |
| InChIKey | MFSYLIFJRWISEP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |