C8H9F3N2O — CID 143808992
(3E,5Z)-6-amino-4-(trifluoromethoxy)hepta-3,5-dienenitrile (PubChem CID 143808992) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is (3E,5Z)-6-amino-4-(trifluoromethoxy)hepta-3,5-dienenitrile.
| Compound Name | (3E,5Z)-6-amino-4-(trifluoromethoxy)hepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 143808992 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (3E,5Z)-6-amino-4-(trifluoromethoxy)hepta-3,5-dienenitrile |
| SMILES | C/C(N)=C/C(=C\CC#N)OC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O/c1-6(13)5-7(3-2-4-12)14-8(9,10)11/h3,5H,2,13H2,1H3/b6-5-,7-3+ |
| InChIKey | ZRHJXHOIJVOOOY-KQVMHNMJSA-N |
| XLogP | 2.18 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|