C11H16F3NO — CID 178040888
(2E,4Z,6Z)-6-(trifluoromethoxy)deca-2,4,6-trien-2-amine (PubChem CID 178040888) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is (2E,4Z,6Z)-6-(trifluoromethoxy)deca-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z,6Z)-6-(trifluoromethoxy)deca-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 178040888 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (2E,4Z,6Z)-6-(trifluoromethoxy)deca-2,4,6-trien-2-amine |
| SMILES | CCC/C=C(/C=C\C=C(/C)N)OC(F)(F)F |
| InChI | InChI=1S/C11H16F3NO/c1-3-4-7-10(16-11(12,13)14)8-5-6-9(2)15/h5-8H,3-4,15H2,1-2H3/b8-5-,9-6+,10-7- |
| InChIKey | XTFHWUMNVYSJBW-YJPPJNGCSA-N |
| XLogP | 3.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|