C20H28F3NO — CID 166907514
(3Z,4Z)-4-ethenyl-6-ethyl-5-methoxy-3-[2-(trifluoromethyl)pent-2-enylidene]nona-1,4,6-trien-2-amine (PubChem CID 166907514) has the molecular formula C20H28F3NO and a molecular weight of 355.44 g/mol. Its IUPAC name is (3Z,4Z)-4-ethenyl-6-ethyl-5-methoxy-3-[2-(trifluoromethyl)pent-2-enylidene]nona-1,4,6-trien-2-amine.
| Compound Name | (3Z,4Z)-4-ethenyl-6-ethyl-5-methoxy-3-[2-(trifluoromethyl)pent-2-enylidene]nona-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 166907514 |
| Molecular Formula | C20H28F3NO |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (3Z,4Z)-4-ethenyl-6-ethyl-5-methoxy-3-[2-(trifluoromethyl)pent-2-enylidene]nona-1,4,6-trien-2-amine |
| SMILES | C=C/C(C(=CC(=CCC)C(F)(F)F)C(=C)N)=C(/OC)C(=CCC)CC |
| InChI | InChI=1S/C20H28F3NO/c1-7-11-15(9-3)19(25-6)17(10-4)18(14(5)24)13-16(12-8-2)20(21,22)23/h10-13H,4-5,7-9,24H2,1-3,6H3/b15-11?,16-12?,18-13+,19-17- |
| InChIKey | LETSIIARQUYTMQ-ZNDVLEFZSA-N |
| XLogP | 6.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|