C14H18F4N2O — CID 143431971
(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-amine;(3E)-4-(trifluoromethoxy)hexa-1,3,5-trien-2-amine (PubChem CID 143431971) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is (3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-amine;(3E)-4-(trifluoromethoxy)hexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-amine;(3E)-4-(trifluoromethoxy)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143431971 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-amine;(3E)-4-(trifluoromethoxy)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(C)/C=C(/F)C(=C)N.C=C/C(=C\C(=C)N)OC(F)(F)F |
| InChI | InChI=1S/C7H8F3NO.C7H10FN/c1-3-6(4-5(2)11)12-7(8,9)10;1-5(2)4-7(8)6(3)9/h3-4H,1-2,11H2;4H,1,3,9H2,2H3/b6-4+;7-4+ |
| InChIKey | WLYBFQXKVJHUMH-KNFZIHFFSA-N |
| XLogP | 3.95 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|