About ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine
ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine (PubChem CID 144610849) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine.
Molecular Properties
| Compound Name | ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine |
| PubChem CID | 144610849 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(/OC)C(=C)C.CC |
| InChI | InChI=1S/C8H13NO.C2H6/c1-5-7(9)8(10-4)6(2)3;1-2/h5H,1-2,9H2,3-4H3;1-2H3/b8-7-; |
| InChIKey | LEBWRFVFTGFPSJ-CFYXSCKTSA-N |
| XLogP | 2.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine?
The IUPAC name of ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine (CID 144610849) is ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine.
What is the SMILES notation for ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine?
The canonical SMILES for ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine is C=C/C(N)=C(/OC)C(=C)C.CC.
What is the InChIKey of ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine?
The InChIKey is LEBWRFVFTGFPSJ-CFYXSCKTSA-N. The full InChI is InChI=1S/C8H13NO.C2H6/c1-5-7(9)8(10-4)6(2)3;1-2/h5H,1-2,9H2,3-4H3;1-2H3/b8-7-;.
What are the key properties of ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine?
ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine has a molecular weight of 169.27 g/mol, XLogP of 2.59, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-4-methoxy-5-methylhexa-1,3,5-trien-3-amine is sourced from PubChem (CID 144610849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).