C11H16F3NO — CID 155442227
(2Z,4E,6Z)-6-ethoxy-8,8,9-trifluoronona-2,4,6-trien-4-amine (PubChem CID 155442227) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is (2Z,4E,6Z)-6-ethoxy-8,8,9-trifluoronona-2,4,6-trien-4-amine.
| Compound Name | (2Z,4E,6Z)-6-ethoxy-8,8,9-trifluoronona-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 155442227 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (2Z,4E,6Z)-6-ethoxy-8,8,9-trifluoronona-2,4,6-trien-4-amine |
| SMILES | C/C=C\C(N)=C/C(=C/C(F)(F)CF)OCC |
| InChI | InChI=1S/C11H16F3NO/c1-3-5-9(15)6-10(16-4-2)7-11(13,14)8-12/h3,5-7H,4,8,15H2,1-2H3/b5-3-,9-6+,10-7- |
| InChIKey | XQWIJLJRFAYRDA-DJOAEYODSA-N |
| XLogP | 2.93 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|