C16H20S — CID 143809053
4,10,10-trimethyl-2,4,6,7-tetrahydroindeno[1,2-d]thiepine (PubChem CID 143809053) has the molecular formula C16H20S and a molecular weight of 244.40 g/mol. Its IUPAC name is 4,10,10-trimethyl-2,4,6,7-tetrahydroindeno[1,2-d]thiepine.
| Compound Name | 4,10,10-trimethyl-2,4,6,7-tetrahydroindeno[1,2-d]thiepine |
|---|---|
| PubChem CID | 143809053 |
| Molecular Formula | C16H20S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4,10,10-trimethyl-2,4,6,7-tetrahydroindeno[1,2-d]thiepine |
| SMILES | CC1C=C2C(=CCS1)C(C)(C)C1=C2CCC=C1 |
| InChI | InChI=1S/C16H20S/c1-11-10-13-12-6-4-5-7-14(12)16(2,3)15(13)8-9-17-11/h5,7-8,10-11H,4,6,9H2,1-3H3 |
| InChIKey | NHOCBDOAUGTTLH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |