C26H36N4O2 — CID 143809854
(2E,3E)-1-cyclopentyl-3-ethylidene-2-[1-(2-methoxy-4-methylanilino)ethenylimino]-4-methyl-6-prop-2-enyl-1,4-diazepan-5-one (PubChem CID 143809854) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is (2E,3E)-1-cyclopentyl-3-ethylidene-2-[1-(2-methoxy-4-methylanilino)ethenylimino]-4-methyl-6-prop-2-enyl-1,4-diazepan-5-one.
| Compound Name | (2E,3E)-1-cyclopentyl-3-ethylidene-2-[1-(2-methoxy-4-methylanilino)ethenylimino]-4-methyl-6-prop-2-enyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 143809854 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (2E,3E)-1-cyclopentyl-3-ethylidene-2-[1-(2-methoxy-4-methylanilino)ethenylimino]-4-methyl-6-prop-2-enyl-1,4-diazepan-5-one |
| SMILES | C=CCC1CN(C2CCCC2)C(=N/C(=C)Nc2ccc(C)cc2OC)/C(=C\C)N(C)C1=O |
| InChI | InChI=1S/C26H36N4O2/c1-7-11-20-17-30(21-12-9-10-13-21)25(23(8-2)29(5)26(20)31)28-19(4)27-22-15-14-18(3)16-24(22)32-6/h7-8,14-16,20-21,27H,1,4,9-13,17H2,2-3,5-6H3/b23-8+,28-25+ |
| InChIKey | IWISVAIVDBWUMG-VLFATWLVSA-N |
| XLogP | 5.10 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|