C26H33F3N4O2 — CID 143810846
methyl 1-(4-cyanopiperidine-1-carbonyl)-N-(3-methylbut-1-en-2-yl)-5-[4-(trifluoromethyl)phenyl]piperidine-3-carboximidate (PubChem CID 143810846) has the molecular formula C26H33F3N4O2 and a molecular weight of 490.57 g/mol. Its IUPAC name is methyl 1-(4-cyanopiperidine-1-carbonyl)-N-(3-methylbut-1-en-2-yl)-5-[4-(trifluoromethyl)phenyl]piperidine-3-carboximidate.
| Compound Name | methyl 1-(4-cyanopiperidine-1-carbonyl)-N-(3-methylbut-1-en-2-yl)-5-[4-(trifluoromethyl)phenyl]piperidine-3-carboximidate |
|---|---|
| PubChem CID | 143810846 |
| Molecular Formula | C26H33F3N4O2 |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | methyl 1-(4-cyanopiperidine-1-carbonyl)-N-(3-methylbut-1-en-2-yl)-5-[4-(trifluoromethyl)phenyl]piperidine-3-carboximidate |
| SMILES | C=C(/N=C(\OC)C1CC(c2ccc(C(F)(F)F)cc2)CN(C(=O)N2CCC(C#N)CC2)C1)C(C)C |
| InChI | InChI=1S/C26H33F3N4O2/c1-17(2)18(3)31-24(35-4)22-13-21(20-5-7-23(8-6-20)26(27,28)29)15-33(16-22)25(34)32-11-9-19(14-30)10-12-32/h5-8,17,19,21-22H,3,9-13,15-16H2,1-2,4H3/b31-24- |
| InChIKey | FSRUYFCBWOBZHE-QLTSDVKISA-N |
| XLogP | 5.68 |
| TPSA | 68.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|