C15H25N3OS — CID 143812148
ethane;(1-phenylsulfanylpiperidin-3-yl)methylurea (PubChem CID 143812148) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is ethane;(1-phenylsulfanylpiperidin-3-yl)methylurea.
| Compound Name | ethane;(1-phenylsulfanylpiperidin-3-yl)methylurea |
|---|---|
| PubChem CID | 143812148 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | ethane;(1-phenylsulfanylpiperidin-3-yl)methylurea |
| SMILES | CC.NC(=O)NCC1CCCN(Sc2ccccc2)C1 |
| InChI | InChI=1S/C13H19N3OS.C2H6/c14-13(17)15-9-11-5-4-8-16(10-11)18-12-6-2-1-3-7-12;1-2/h1-3,6-7,11H,4-5,8-10H2,(H3,14,15,17);1-2H3 |
| InChIKey | DYJKCVQJPQPTHR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|