C20H32N2OS — CID 96542414
2-methyl-N-[[(3R)-1-[(2S)-4-phenylsulfanylbutan-2-yl]piperidin-3-yl]methyl]propanamide (PubChem CID 96542414) has the molecular formula C20H32N2OS and a molecular weight of 348.56 g/mol. Its IUPAC name is 2-methyl-N-[[(3R)-1-[(2S)-4-phenylsulfanylbutan-2-yl]piperidin-3-yl]methyl]propanamide.
| Compound Name | 2-methyl-N-[[(3R)-1-[(2S)-4-phenylsulfanylbutan-2-yl]piperidin-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 96542414 |
| Molecular Formula | C20H32N2OS |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 2-methyl-N-[[(3R)-1-[(2S)-4-phenylsulfanylbutan-2-yl]piperidin-3-yl]methyl]propanamide |
| SMILES | CC(C)C(=O)NC[C@H]1CCCN([C@@H](C)CCSc2ccccc2)C1 |
| InChI | InChI=1S/C20H32N2OS/c1-16(2)20(23)21-14-18-8-7-12-22(15-18)17(3)11-13-24-19-9-5-4-6-10-19/h4-6,9-10,16-18H,7-8,11-15H2,1-3H3,(H,21,23)/t17-,18+/m0/s1 |
| InChIKey | GKVCLBCFBQHXGF-ZWKOTPCHSA-N |
| XLogP | 4.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |