C18H28N2OS — CID 71850304
N-[1-(4-phenylsulfanylbutan-2-yl)piperidin-3-yl]propanamide (PubChem CID 71850304) has the molecular formula C18H28N2OS and a molecular weight of 320.50 g/mol. Its IUPAC name is N-[1-(4-phenylsulfanylbutan-2-yl)piperidin-3-yl]propanamide.
| Compound Name | N-[1-(4-phenylsulfanylbutan-2-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 71850304 |
| Molecular Formula | C18H28N2OS |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-[1-(4-phenylsulfanylbutan-2-yl)piperidin-3-yl]propanamide |
| SMILES | CCC(=O)NC1CCCN(C(C)CCSc2ccccc2)C1 |
| InChI | InChI=1S/C18H28N2OS/c1-3-18(21)19-16-8-7-12-20(14-16)15(2)11-13-22-17-9-5-4-6-10-17/h4-6,9-10,15-16H,3,7-8,11-14H2,1-2H3,(H,19,21) |
| InChIKey | DLGNDWTWKHHPGJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |