C17H25ClN2OS — CID 56510280
N-[1-[3-(2-chlorophenyl)sulfanylpropyl]piperidin-3-yl]propanamide (PubChem CID 56510280) has the molecular formula C17H25ClN2OS and a molecular weight of 340.92 g/mol. Its IUPAC name is N-[1-[3-(2-chlorophenyl)sulfanylpropyl]piperidin-3-yl]propanamide.
| Compound Name | N-[1-[3-(2-chlorophenyl)sulfanylpropyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 56510280 |
| Molecular Formula | C17H25ClN2OS |
| Molecular Weight | 340.92 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[1-[3-(2-chlorophenyl)sulfanylpropyl]piperidin-3-yl]propanamide |
| SMILES | CCC(=O)NC1CCCN(CCCSc2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H25ClN2OS/c1-2-17(21)19-14-7-5-10-20(13-14)11-6-12-22-16-9-4-3-8-15(16)18/h3-4,8-9,14H,2,5-7,10-13H2,1H3,(H,19,21) |
| InChIKey | FKQNOYCQXBMDJJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|