C22H19F3N4O2 — CID 143812928
2-(benzylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 143812928) has the molecular formula C22H19F3N4O2 and a molecular weight of 428.41 g/mol. Its IUPAC name is 2-(benzylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | 2-(benzylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 143812928 |
| Molecular Formula | C22H19F3N4O2 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-(benzylamino)-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | NC(=O)c1cc(NC(=O)Nc2cccc(C(F)(F)F)c2)ccc1NCc1ccccc1 |
| InChI | InChI=1S/C22H19F3N4O2/c23-22(24,25)15-7-4-8-16(11-15)28-21(31)29-17-9-10-19(18(12-17)20(26)30)27-13-14-5-2-1-3-6-14/h1-12,27H,13H2,(H2,26,30)(H2,28,29,31) |
| InChIKey | QSVBOIHVUWMOOA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |