C14H16O4 — CID 14381305
1-propyl-1,3-dihydroindene-2,2-dicarboxylic acid (PubChem CID 14381305) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-propyl-1,3-dihydroindene-2,2-dicarboxylic acid.
| Compound Name | 1-propyl-1,3-dihydroindene-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 14381305 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-propyl-1,3-dihydroindene-2,2-dicarboxylic acid |
| SMILES | CCCC1c2ccccc2CC1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H16O4/c1-2-5-11-10-7-4-3-6-9(10)8-14(11,12(15)16)13(17)18/h3-4,6-7,11H,2,5,8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | VORVBXUDDJUTEP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|