C20H17F3N6O3S — CID 143813281
2-(1-benzofuran-5-ylamino)-4-[[2-[methyl(sulfino)amino]-3-pyridinyl]methylamino]-5-(trifluoromethyl)pyrimidine (PubChem CID 143813281) has the molecular formula C20H17F3N6O3S and a molecular weight of 478.46 g/mol. Its IUPAC name is 2-(1-benzofuran-5-ylamino)-4-[[2-[methyl(sulfino)amino]-3-pyridinyl]methylamino]-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2-(1-benzofuran-5-ylamino)-4-[[2-[methyl(sulfino)amino]-3-pyridinyl]methylamino]-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 143813281 |
| Molecular Formula | C20H17F3N6O3S |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-(1-benzofuran-5-ylamino)-4-[[2-[methyl(sulfino)amino]-3-pyridinyl]methylamino]-5-(trifluoromethyl)pyrimidine |
| SMILES | CN(c1ncccc1CNc1nc(Nc2ccc3occc3c2)ncc1C(F)(F)F)S(=O)O |
| InChI | InChI=1S/C20H17F3N6O3S/c1-29(33(30)31)18-13(3-2-7-24-18)10-25-17-15(20(21,22)23)11-26-19(28-17)27-14-4-5-16-12(9-14)6-8-32-16/h2-9,11H,10H2,1H3,(H,30,31)(H2,25,26,27,28) |
| InChIKey | PSBLZNHGHOYIEZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|