C18H29N3O — CID 143813391
(Z)-3-(1-pentylpyrrolidin-3-yl)oxy-1-phenylprop-1-ene-1,2-diamine (PubChem CID 143813391) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is (Z)-3-(1-pentylpyrrolidin-3-yl)oxy-1-phenylprop-1-ene-1,2-diamine.
| Compound Name | (Z)-3-(1-pentylpyrrolidin-3-yl)oxy-1-phenylprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 143813391 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | (Z)-3-(1-pentylpyrrolidin-3-yl)oxy-1-phenylprop-1-ene-1,2-diamine |
| SMILES | CCCCCN1CCC(OC/C(N)=C(/N)c2ccccc2)C1 |
| InChI | InChI=1S/C18H29N3O/c1-2-3-7-11-21-12-10-16(13-21)22-14-17(19)18(20)15-8-5-4-6-9-15/h4-6,8-9,16H,2-3,7,10-14,19-20H2,1H3/b18-17- |
| InChIKey | IPCGBVPGILRSSD-ZCXUNETKSA-N |
| XLogP | 2.55 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|