C20H19CrNO6 — CID 135004183
carbon monoxide;[(E)-1-ethoxy-3-phenyl-3-pyrrolidin-1-ylprop-2-enylidene]chromium (PubChem CID 135004183) has the molecular formula C20H19CrNO6 and a molecular weight of 421.37 g/mol. Its IUPAC name is carbon monoxide;[(E)-1-ethoxy-3-phenyl-3-pyrrolidin-1-ylprop-2-enylidene]chromium.
| Compound Name | carbon monoxide;[(E)-1-ethoxy-3-phenyl-3-pyrrolidin-1-ylprop-2-enylidene]chromium |
|---|---|
| PubChem CID | 135004183 |
| Molecular Formula | C20H19CrNO6 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | carbon monoxide;[(E)-1-ethoxy-3-phenyl-3-pyrrolidin-1-ylprop-2-enylidene]chromium |
| SMILES | CCOC(=[Cr])/C=C(\c1ccccc1)N1CCCC1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C15H19NO.5CO.Cr/c1-2-17-13-10-15(16-11-6-7-12-16)14-8-4-3-5-9-14;5*1-2;/h3-5,8-10H,2,6-7,11-12H2,1H3;;;;;;/b15-10+;;;;;; |
| InChIKey | SBTYOLSDEIFHMO-JYWHLQINSA-N |
| XLogP | 2.65 |
| TPSA | 111.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|