C20H23NO2 — CID 16663440
ethyl (2Z)-2-(2-benzyl-1,3,6,7-tetrahydrocyclohepta[c]pyrrol-5-ylidene)acetate (PubChem CID 16663440) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is ethyl (2Z)-2-(2-benzyl-1,3,6,7-tetrahydrocyclohepta[c]pyrrol-5-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(2-benzyl-1,3,6,7-tetrahydrocyclohepta[c]pyrrol-5-ylidene)acetate |
|---|---|
| PubChem CID | 16663440 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethyl (2Z)-2-(2-benzyl-1,3,6,7-tetrahydrocyclohepta[c]pyrrol-5-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\C=C2CN(Cc3ccccc3)CC2=CCC1 |
| InChI | InChI=1S/C20H23NO2/c1-2-23-20(22)12-17-9-6-10-18-14-21(15-19(18)11-17)13-16-7-4-3-5-8-16/h3-5,7-8,10-12H,2,6,9,13-15H2,1H3/b17-12- |
| InChIKey | UQFRQPUSXMCYER-ATVHPVEESA-N |
| XLogP | 3.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|