C24H36FNO — CID 142549997
(3E,5Z)-N-[(4-fluorophenyl)methyl]-7-methoxy-N-octylocta-3,5,7-trien-4-amine (PubChem CID 142549997) has the molecular formula C24H36FNO and a molecular weight of 373.56 g/mol. Its IUPAC name is (3E,5Z)-N-[(4-fluorophenyl)methyl]-7-methoxy-N-octylocta-3,5,7-trien-4-amine.
| Compound Name | (3E,5Z)-N-[(4-fluorophenyl)methyl]-7-methoxy-N-octylocta-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 142549997 |
| Molecular Formula | C24H36FNO |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | (3E,5Z)-N-[(4-fluorophenyl)methyl]-7-methoxy-N-octylocta-3,5,7-trien-4-amine |
| SMILES | C=C(/C=C\C(=C/CC)N(CCCCCCCC)Cc1ccc(F)cc1)OC |
| InChI | InChI=1S/C24H36FNO/c1-5-7-8-9-10-11-19-26(20-22-14-16-23(25)17-15-22)24(12-6-2)18-13-21(3)27-4/h12-18H,3,5-11,19-20H2,1-2,4H3/b18-13-,24-12+ |
| InChIKey | KTZMEGBOMCSVNP-DIZMWVFMSA-N |
| XLogP | 7.00 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|