About [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide
[(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide (PubChem CID 134867562) has the molecular formula C23H19CrNO6
and a molecular weight of 457.40 g/mol. Its IUPAC name is [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide.
Molecular Properties
| Compound Name | [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide |
| PubChem CID | 134867562 |
| Molecular Formula | C23H19CrNO6 |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide |
| SMILES | CCOC(=[Cr])/C=C(\NCc1ccccc1)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C18H19NO.5CO.Cr/c1-2-20-14-13-18(17-11-7-4-8-12-17)19-15-16-9-5-3-6-10-16;5*1-2;/h3-13,19H,2,15H2,1H3;;;;;;/b18-13-;;;;;; |
| InChIKey | SRBKSBYDAYVNEN-WFXDEIRESA-N |
| XLogP | 3.34 |
| TPSA | 120.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide?
The IUPAC name of [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide (CID 134867562) is [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide.
What is the SMILES notation for [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide?
The canonical SMILES for [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide is CCOC(=[Cr])/C=C(\NCc1ccccc1)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].
What is the InChIKey of [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide?
The InChIKey is SRBKSBYDAYVNEN-WFXDEIRESA-N. The full InChI is InChI=1S/C18H19NO.5CO.Cr/c1-2-20-14-13-18(17-11-7-4-8-12-17)19-15-16-9-5-3-6-10-16;5*1-2;/h3-13,19H,2,15H2,1H3;;;;;;/b18-13-;;;;;;.
What are the key properties of [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide?
[(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide has a molecular weight of 457.40 g/mol, XLogP of 3.34, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-(benzylamino)-1-ethoxy-3-phenylprop-2-enylidene]chromium;carbon monoxide is sourced from PubChem (CID 134867562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).