C18H23F2NS — CID 143814366
2-[(2E,4Z)-1,6-difluorohexa-2,4-dien-3-yl]-3-[(2Z,4E)-4-methylsulfanylhexa-2,4-dienyl]cyclopent-2-en-1-imine (PubChem CID 143814366) has the molecular formula C18H23F2NS and a molecular weight of 323.45 g/mol. Its IUPAC name is 2-[(2E,4Z)-1,6-difluorohexa-2,4-dien-3-yl]-3-[(2Z,4E)-4-methylsulfanylhexa-2,4-dienyl]cyclopent-2-en-1-imine.
| Compound Name | 2-[(2E,4Z)-1,6-difluorohexa-2,4-dien-3-yl]-3-[(2Z,4E)-4-methylsulfanylhexa-2,4-dienyl]cyclopent-2-en-1-imine |
|---|---|
| PubChem CID | 143814366 |
| Molecular Formula | C18H23F2NS |
| Molecular Weight | 323.45 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[(2E,4Z)-1,6-difluorohexa-2,4-dien-3-yl]-3-[(2Z,4E)-4-methylsulfanylhexa-2,4-dienyl]cyclopent-2-en-1-imine |
| SMILES | [H]/N=C1\CCC(C/C=C\C(=C/C)SC)=C1C(/C=C\CF)=C/CF |
| InChI | InChI=1S/C18H23F2NS/c1-3-16(22-2)8-4-6-14-9-10-17(21)18(14)15(11-13-20)7-5-12-19/h3-5,7-8,11,21H,6,9-10,12-13H2,1-2H3/b7-5-,8-4-,15-11+,16-3+,21-17+ |
| InChIKey | GSAXXSGOXZZCRR-ZDCXXTGKSA-N |
| XLogP | 5.73 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.45 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|