C20H26F3N — CID 143814370
acetylene;2-[(Z)-4-fluorobut-2-enyl]-3-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]cyclopent-2-en-1-imine;fluoroethane (PubChem CID 143814370) has the molecular formula C20H26F3N and a molecular weight of 337.43 g/mol. Its IUPAC name is acetylene;2-[(Z)-4-fluorobut-2-enyl]-3-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]cyclopent-2-en-1-imine;fluoroethane.
| Compound Name | acetylene;2-[(Z)-4-fluorobut-2-enyl]-3-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]cyclopent-2-en-1-imine;fluoroethane |
|---|---|
| PubChem CID | 143814370 |
| Molecular Formula | C20H26F3N |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | acetylene;2-[(Z)-4-fluorobut-2-enyl]-3-[(2E,4E)-5-fluorohepta-2,4,6-trien-2-yl]cyclopent-2-en-1-imine;fluoroethane |
| SMILES | C#C.CCF.[H]/N=C1\CCC(/C(C)=C/C=C(/F)C=C)=C1C/C=C\CF |
| InChI | InChI=1S/C16H19F2N.C2H5F.C2H2/c1-3-13(18)8-7-12(2)14-9-10-16(19)15(14)6-4-5-11-17;1-2-3;1-2/h3-5,7-8,19H,1,6,9-11H2,2H3;2H2,1H3;1-2H/b5-4-,12-7+,13-8+,19-16+;; |
| InChIKey | RZTSCIMZNLXIDT-AWZQBUKASA-N |
| XLogP | 6.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|