C16H27N — CID 123235683
11-ethylidenetetradeca-9,12-dien-5-imine (PubChem CID 123235683) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is 11-ethylidenetetradeca-9,12-dien-5-imine.
| Compound Name | 11-ethylidenetetradeca-9,12-dien-5-imine |
|---|---|
| PubChem CID | 123235683 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | 11-ethylidenetetradeca-9,12-dien-5-imine |
| SMILES | [H]/N=C(\CCCC)CCCC=CC(C=CC)=CC |
| InChI | InChI=1S/C16H27N/c1-4-7-13-16(17)14-10-8-9-12-15(6-3)11-5-2/h5-6,9,11-12,17H,4,7-8,10,13-14H2,1-3H3/b11-5?,12-9?,15-6?,17-16+ |
| InChIKey | NNRQTSXCXSENTM-VVILLHNDSA-N |
| XLogP | 5.45 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|