C10H11N — CID 57208179
2-cyclopenta-1,3-dien-1-ylcyclopent-2-en-1-imine (PubChem CID 57208179) has the molecular formula C10H11N and a molecular weight of 145.21 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-ylcyclopent-2-en-1-imine.
| Compound Name | 2-cyclopenta-1,3-dien-1-ylcyclopent-2-en-1-imine |
|---|---|
| PubChem CID | 57208179 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.21 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-ylcyclopent-2-en-1-imine |
| SMILES | [H]/N=C1\CCC=C1C1=CC=CC1 |
| InChI | InChI=1S/C10H11N/c11-10-7-3-6-9(10)8-4-1-2-5-8/h1-2,4,6,11H,3,5,7H2/b11-10+ |
| InChIKey | KXSKJOCNTOCWNK-ZHACJKMWSA-N |
| XLogP | 2.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|