C9H9N — CID 57172893
1,4-dihydroinden-2-imine (PubChem CID 57172893) has the molecular formula C9H9N and a molecular weight of 131.18 g/mol. Its IUPAC name is 1,4-dihydroinden-2-imine.
| Compound Name | 1,4-dihydroinden-2-imine |
|---|---|
| PubChem CID | 57172893 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 1,4-dihydroinden-2-imine |
| SMILES | [H]/N=C1/C=C2CC=CC=C2C1 |
| InChI | InChI=1S/C9H9N/c10-9-5-7-3-1-2-4-8(7)6-9/h1-3,6,10H,4-5H2/b10-9+ |
| InChIKey | YFUHZFUMSLDDSD-MDZDMXLPSA-N |
| XLogP | 2.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|