C19H35N — CID 143718087
ethane;(2Z)-3-ethyl-4-methyl-2-[(Z)-2-methylhex-3-enylidene]cyclopent-3-en-1-imine (PubChem CID 143718087) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is ethane;(2Z)-3-ethyl-4-methyl-2-[(Z)-2-methylhex-3-enylidene]cyclopent-3-en-1-imine.
| Compound Name | ethane;(2Z)-3-ethyl-4-methyl-2-[(Z)-2-methylhex-3-enylidene]cyclopent-3-en-1-imine |
|---|---|
| PubChem CID | 143718087 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | ethane;(2Z)-3-ethyl-4-methyl-2-[(Z)-2-methylhex-3-enylidene]cyclopent-3-en-1-imine |
| SMILES | CC.CC.[H]/N=C1\CC(C)=C(CC)\C1=C\C(C)/C=C\CC |
| InChI | InChI=1S/C15H23N.2C2H6/c1-5-7-8-11(3)9-14-13(6-2)12(4)10-15(14)16;2*1-2/h7-9,11,16H,5-6,10H2,1-4H3;2*1-2H3/b8-7-,14-9-,16-15+;; |
| InChIKey | WFSDLLXWWQQKIC-MHRYZUHISA-N |
| XLogP | 6.72 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|