C16H23N — CID 166776667
(2Z,5E,6Z)-8-(cyclopenten-1-yl)-5-ethylidene-6-methylocta-2,6-dien-4-imine (PubChem CID 166776667) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is (2Z,5E,6Z)-8-(cyclopenten-1-yl)-5-ethylidene-6-methylocta-2,6-dien-4-imine.
| Compound Name | (2Z,5E,6Z)-8-(cyclopenten-1-yl)-5-ethylidene-6-methylocta-2,6-dien-4-imine |
|---|---|
| PubChem CID | 166776667 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | (2Z,5E,6Z)-8-(cyclopenten-1-yl)-5-ethylidene-6-methylocta-2,6-dien-4-imine |
| SMILES | [H]/N=C(\C=C/C)C(=C/C)/C(C)=C\CC1=CCCC1 |
| InChI | InChI=1S/C16H23N/c1-4-8-16(17)15(5-2)13(3)11-12-14-9-6-7-10-14/h4-5,8-9,11,17H,6-7,10,12H2,1-3H3/b8-4-,13-11-,15-5+,17-16+ |
| InChIKey | AQVMBAXOWQRESC-WCQQQSISSA-N |
| XLogP | 4.98 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|