C16H25N — CID 163765893
(10Z,12E)-10-ethenyltetradeca-1,10,12-trien-3-imine (PubChem CID 163765893) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (10Z,12E)-10-ethenyltetradeca-1,10,12-trien-3-imine.
| Compound Name | (10Z,12E)-10-ethenyltetradeca-1,10,12-trien-3-imine |
|---|---|
| PubChem CID | 163765893 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (10Z,12E)-10-ethenyltetradeca-1,10,12-trien-3-imine |
| SMILES | [H]/N=C(\C=C)CCCCCC/C(C=C)=C/C=C/C |
| InChI | InChI=1S/C16H25N/c1-4-7-12-15(5-2)13-10-8-9-11-14-16(17)6-3/h4-7,12,17H,2-3,8-11,13-14H2,1H3/b7-4+,15-12+,17-16+ |
| InChIKey | MCGAFTFUCPAQOX-DPLHOKKLSA-N |
| XLogP | 5.22 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|