C9H16N2O — CID 143815572
1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone;ethane (PubChem CID 143815572) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone;ethane.
| Compound Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone;ethane |
|---|---|
| PubChem CID | 143815572 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-(3,5-dimethyl-1H-pyrazol-4-yl)ethanone;ethane |
| SMILES | CC.CC(=O)c1c(C)n[nH]c1C |
| InChI | InChI=1S/C7H10N2O.C2H6/c1-4-7(6(3)10)5(2)9-8-4;1-2/h1-3H3,(H,8,9);1-2H3 |
| InChIKey | VVIDIMYBMHJDRM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |