C11H14FIN2O — CID 143816419
(NZ)-N-[(5-fluoro-1λ3-iodacyclohexa-1,3,5-trien-2-yl)-piperidin-4-ylmethylidene]hydroxylamine (PubChem CID 143816419) has the molecular formula C11H14FIN2O and a molecular weight of 336.15 g/mol. Its IUPAC name is (NZ)-N-[(5-fluoro-1λ3-iodacyclohexa-1,3,5-trien-2-yl)-piperidin-4-ylmethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(5-fluoro-1λ3-iodacyclohexa-1,3,5-trien-2-yl)-piperidin-4-ylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 143816419 |
| Molecular Formula | C11H14FIN2O |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | (NZ)-N-[(5-fluoro-1λ3-iodacyclohexa-1,3,5-trien-2-yl)-piperidin-4-ylmethylidene]hydroxylamine |
| SMILES | O/N=C(\C1=IC=C(F)C=C1)C1CCNCC1 |
| InChI | InChI=1S/C11H14FIN2O/c12-9-1-2-10(13-7-9)11(15-16)8-3-5-14-6-4-8/h1-2,7-8,14,16H,3-6H2/b15-11- |
| InChIKey | FETMPTGEYVZPLD-PTNGSMBKSA-N |
| XLogP | 2.34 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|