About (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium
(NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium (PubChem CID 59974004) has the molecular formula C12H15N2OY-
and a molecular weight of 292.17 g/mol. Its IUPAC name is (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium.
Molecular Properties
| Compound Name | (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium |
| PubChem CID | 59974004 |
| Molecular Formula | C12H15N2OY- |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium |
| SMILES | O/N=C(/c1[c-]cccc1)C1CCNCC1.[Y] |
| InChI | InChI=1S/C12H15N2O.Y/c15-14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11;/h1-4,11,13,15H,6-9H2;/q-1;/b14-12-; |
| InChIKey | QGPPYQZABRUQSJ-CTMPBGLUSA-N |
| XLogP | 1.66 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium?
The IUPAC name of (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium (CID 59974004) is (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium.
What is the SMILES notation for (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium?
The canonical SMILES for (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium is O/N=C(/c1[c-]cccc1)C1CCNCC1.[Y].
What is the InChIKey of (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium?
The InChIKey is QGPPYQZABRUQSJ-CTMPBGLUSA-N. The full InChI is InChI=1S/C12H15N2O.Y/c15-14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11;/h1-4,11,13,15H,6-9H2;/q-1;/b14-12-;.
What are the key properties of (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium?
(NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium has a molecular weight of 292.17 g/mol, XLogP of 1.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[phenyl(piperidin-4-yl)methylidene]hydroxylamine;yttrium is sourced from PubChem (CID 59974004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).