C15H25N3O — CID 143816495
2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(3-methyl-2-methylidenebut-3-enyl)acetamide;ethane (PubChem CID 143816495) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(3-methyl-2-methylidenebut-3-enyl)acetamide;ethane.
| Compound Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(3-methyl-2-methylidenebut-3-enyl)acetamide;ethane |
|---|---|
| PubChem CID | 143816495 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-(3-methyl-2-methylidenebut-3-enyl)acetamide;ethane |
| SMILES | C=C(C)C(=C)CNC(=O)Cc1c(C)n[nH]c1C.CC |
| InChI | InChI=1S/C13H19N3O.C2H6/c1-8(2)9(3)7-14-13(17)6-12-10(4)15-16-11(12)5;1-2/h1,3,6-7H2,2,4-5H3,(H,14,17)(H,15,16);1-2H3 |
| InChIKey | FPXOCHGQYRRSRN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|