C29H35N3O2S — CID 143816577
3-(4-ethyl-6-methylindazol-1-yl)benzoic acid;N-(2,4,6-trimethylphenyl)sulfanylpropan-1-amine (PubChem CID 143816577) has the molecular formula C29H35N3O2S and a molecular weight of 489.69 g/mol. Its IUPAC name is 3-(4-ethyl-6-methylindazol-1-yl)benzoic acid;N-(2,4,6-trimethylphenyl)sulfanylpropan-1-amine.
| Compound Name | 3-(4-ethyl-6-methylindazol-1-yl)benzoic acid;N-(2,4,6-trimethylphenyl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 143816577 |
| Molecular Formula | C29H35N3O2S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 3-(4-ethyl-6-methylindazol-1-yl)benzoic acid;N-(2,4,6-trimethylphenyl)sulfanylpropan-1-amine |
| SMILES | CCCNSc1c(C)cc(C)cc1C.CCc1cc(C)cc2c1cnn2-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C17H16N2O2.C12H19NS/c1-3-12-7-11(2)8-16-15(12)10-18-19(16)14-6-4-5-13(9-14)17(20)21;1-5-6-13-14-12-10(3)7-9(2)8-11(12)4/h4-10H,3H2,1-2H3,(H,20,21);7-8,13H,5-6H2,1-4H3 |
| InChIKey | MZZUGSQBPWFJPX-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|