C31H37N5O4S2 — CID 143816598
N-(1,1-dioxothiolan-3-yl)-3-[4-[2-[(2-methoxy-4,6-dimethylphenyl)sulfanylamino]propylamino]-6-methylindazol-1-yl]benzamide (PubChem CID 143816598) has the molecular formula C31H37N5O4S2 and a molecular weight of 607.80 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[4-[2-[(2-methoxy-4,6-dimethylphenyl)sulfanylamino]propylamino]-6-methylindazol-1-yl]benzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[4-[2-[(2-methoxy-4,6-dimethylphenyl)sulfanylamino]propylamino]-6-methylindazol-1-yl]benzamide |
|---|---|
| PubChem CID | 143816598 |
| Molecular Formula | C31H37N5O4S2 |
| Molecular Weight | 607.80 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[4-[2-[(2-methoxy-4,6-dimethylphenyl)sulfanylamino]propylamino]-6-methylindazol-1-yl]benzamide |
| SMILES | COc1cc(C)cc(C)c1SNC(C)CNc1cc(C)cc2c1cnn2-c1cccc(C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C31H37N5O4S2/c1-19-11-21(3)30(29(14-19)40-5)41-35-22(4)16-32-27-12-20(2)13-28-26(27)17-33-36(28)25-8-6-7-23(15-25)31(37)34-24-9-10-42(38,39)18-24/h6-8,11-15,17,22,24,32,35H,9-10,16,18H2,1-5H3,(H,34,37) |
| InChIKey | DKABVCIQVITJON-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.80 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|